CAS 136649-44-0 appears in our catalog under these names: 3-BROMO-5-IODO-1,1'-BIPHENYL, 95%, 95%, 3-Bromo-5-iodo-1,1'-biphenyl, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3-iodo-5-phenylbenzene (CAS 136649-44-0) is a chemical compound with the molecular formula C12H8BrI and a molecular weight of 359.00 g/mol. IUPAC name: 1-bromo-3-iodo-5-phenylbenzene. InChIKey: CIWAIMKQRNQGES-UHFFFAOYSA-N.
| Molecular formula | C12H8BrI |
|---|---|
| Molecular weight | 359.00 g/mol |
| IUPAC name | 1-bromo-3-iodo-5-phenylbenzene |
| InChIKey | CIWAIMKQRNQGES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)I)Br |
Computed by PubChem (NCBI)