Products 900806-53-3
CAS 900806-53-3 appears in our catalog under these names: 3-Bromo-4-iodo-1,1'-biphenyl, 97%, 97%, 2–Bromo–1–iodo–4–phenylbenzene. Offered by: Chemat, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g.
2-bromo-1-iodo-4-phenylbenzene (CAS 900806-53-3) is a chemical compound with the molecular formula C12H8BrI and a molecular weight of 359.00 g/mol. IUPAC name: 2-bromo-1-iodo-4-phenylbenzene. InChIKey: RWQLKZHFRDFSFA-UHFFFAOYSA-N.
| Molecular formula | C12H8BrI |
|---|---|
| Molecular weight | 359.00 g/mol |
| IUPAC name | 2-bromo-1-iodo-4-phenylbenzene |
| InChIKey | RWQLKZHFRDFSFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)I)Br |
Computed by PubChem (NCBI)