CAS 55157-87-4 is the registry number for 5-Bromo-6-iodo-1,2-dihydroacenaphthylene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-iodo-1,2-dihydroacenaphthylene (CAS 55157-87-4) is a chemical compound with the molecular formula C12H8BrI and a molecular weight of 359.00 g/mol. IUPAC name: 5-bromo-6-iodo-1,2-dihydroacenaphthylene. InChIKey: PGOBQZKSPOWIRW-UHFFFAOYSA-N.
| Molecular formula | C12H8BrI |
|---|---|
| Molecular weight | 359.00 g/mol |
| IUPAC name | 5-bromo-6-iodo-1,2-dihydroacenaphthylene |
| InChIKey | PGOBQZKSPOWIRW-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=C(C=CC1=C23)Br)I |
Computed by PubChem (NCBI)