Products 39655-12-4

CAS 39655-12-4 is the registry number for 2-BROMO-2'-IODO-1,1'-BIPHENYL, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-bromo-2-(2-iodophenyl)benzene (CAS 39655-12-4) is a chemical compound with the molecular formula C12H8BrI and a molecular weight of 359.00 g/mol. IUPAC name: 1-bromo-2-(2-iodophenyl)benzene. InChIKey: OUIGKVGELUUMGW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8BrI
Molecular weight359.00 g/mol
IUPAC name1-bromo-2-(2-iodophenyl)benzene
InChIKeyOUIGKVGELUUMGW-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=CC=C2I)Br

Computed by PubChem (NCBI)