CAS 187275-73-6 appears in our catalog under these names: 3-Bromo-4'-iodo-1,1'-biphenyl, 96%, 3-Bromo-4'-iodo-1,1'-biphenyl, 98%, 3′–Bromo–4–Iodo–Biphenyl, 3-Bromo-4'-iodo-1,1'-biphenyl, >95.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 200mg.
1-bromo-3-(4-iodophenyl)benzene (CAS 187275-73-6) is a chemical compound with the molecular formula C12H8BrI and a molecular weight of 359.00 g/mol. IUPAC name: 1-bromo-3-(4-iodophenyl)benzene. InChIKey: HPCKEAXEWARUIH-UHFFFAOYSA-N.
| Molecular formula | C12H8BrI |
|---|---|
| Molecular weight | 359.00 g/mol |
| IUPAC name | 1-bromo-3-(4-iodophenyl)benzene |
| InChIKey | HPCKEAXEWARUIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)