Products 1367829-85-3

CAS 1367829-85-3 is the registry number for 2-(4,5,6,7-Tetrahydrothieno[3,2-c]pyridin-4-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)acetic acid (CAS 1367829-85-3) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)acetic acid. InChIKey: SSYZJKHRNUWKNI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2S
Molecular weight197.26 g/mol
IUPAC name2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)acetic acid
InChIKeySSYZJKHRNUWKNI-UHFFFAOYSA-N
SMILESC1CNC(C2=C1SC=C2)CC(=O)O

Computed by PubChem (NCBI)