CAS 1367948-79-5 appears in our catalog under these names: 6-Fluorobenzofuran-2-carbaldehyde 95%, 6-Fluorobenzofuran-2-carbaldehyde, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-fluoro-1-benzofuran-2-carbaldehyde (CAS 1367948-79-5) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 6-fluoro-1-benzofuran-2-carbaldehyde. InChIKey: NFBQLKXQOGZXBF-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 6-fluoro-1-benzofuran-2-carbaldehyde |
| InChIKey | NFBQLKXQOGZXBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)OC(=C2)C=O |
Computed by PubChem (NCBI)