Products 1368217-07-5
CAS 1368217-07-5 is the registry number for Methyl 2-bromo-4,5-dimethylbenzoate, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Methyl 2-bromo-4,5-dimethylbenzoate (CAS 1368217-07-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 2-bromo-4,5-dimethylbenzoate. InChIKey: FHHFAPUCLCLOQG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 2-bromo-4,5-dimethylbenzoate |
| InChIKey | FHHFAPUCLCLOQG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)C(=O)OC |
Computed by PubChem (NCBI)