CAS 1368380-95-3 is the registry number for 1-Bromo-6-nitro-isoquinoline. Offered by: TRC. Available pack sizes: 250mg.
1-bromo-6-nitroisoquinoline (CAS 1368380-95-3) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 1-bromo-6-nitroisoquinoline. InChIKey: VRIOYVYPKSMYKT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 1-bromo-6-nitroisoquinoline |
| InChIKey | VRIOYVYPKSMYKT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Br)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)