Products 1934400-55-1
CAS 1934400-55-1 appears in our catalog under these names: 4-(Fluorosulfonyl)-2-methylbenzoic acid, 4-(Fluorosulfonyl)-2-methylbenzoic acid 95%, 4-(Fluorosulfonyl)-2-methylbenzoic acid, 95%, 95%, 4-(FLUOROSULFONYL)-2-METHYLBENZOIC ACID, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 50mg, 250mg, 5g.
4-fluorosulfonyl-2-methylbenzoic acid (CAS 1934400-55-1) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 4-fluorosulfonyl-2-methylbenzoic acid. InChIKey: KNWRRJFDXKCHRW-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 4-fluorosulfonyl-2-methylbenzoic acid |
| InChIKey | KNWRRJFDXKCHRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)