CAS 1368915-26-7 is the registry number for 2-(4-Bromobenzyl)-4,5-dimethyloxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(4-bromophenyl)methyl]-4,5-dimethyl-1,3-oxazole (CAS 1368915-26-7) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]-4,5-dimethyl-1,3-oxazole. InChIKey: ZQCQREACQNYOLZ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]-4,5-dimethyl-1,3-oxazole |
| InChIKey | ZQCQREACQNYOLZ-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)CC2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)