CAS 23976-55-8 is the registry number for 4-(Bromomethyl)-6,8-dimethyl-1,2-dihydroquinolin-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-(bromomethyl)-6,8-dimethyl-1H-quinolin-2-one (CAS 23976-55-8) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 4-(bromomethyl)-6,8-dimethyl-1H-quinolin-2-one. InChIKey: SRTASJMBMIZXRW-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 4-(bromomethyl)-6,8-dimethyl-1H-quinolin-2-one |
| InChIKey | SRTASJMBMIZXRW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=O)N2)CBr)C |
Computed by PubChem (NCBI)