Products 50776-22-2
CAS 50776-22-2 is the registry number for 2-Bromo-1-(2-methyl-1h-indol-3-yl)propan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-bromo-1-(2-methyl-1H-indol-3-yl)propan-1-one (CAS 50776-22-2) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 2-bromo-1-(2-methyl-1H-indol-3-yl)propan-1-one. InChIKey: JWQKHKFFXCCSMT-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 2-bromo-1-(2-methyl-1H-indol-3-yl)propan-1-one |
| InChIKey | JWQKHKFFXCCSMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C(=O)C(C)Br |
Computed by PubChem (NCBI)