CAS 785785-26-4 is the registry number for 5-Bromo-1-cyclopropanecarbonyl-2,3-dihydro-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-bromo-2,3-dihydroindol-1-yl)-cyclopropylmethanone (CAS 785785-26-4) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: (5-bromo-2,3-dihydroindol-1-yl)-cyclopropylmethanone. InChIKey: BVAWFINKUOQEFE-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | (5-bromo-2,3-dihydroindol-1-yl)-cyclopropylmethanone |
| InChIKey | BVAWFINKUOQEFE-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)N2CCC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)