CAS 68890-19-7 appears in our catalog under these names: 3-((2-Bromophenyl)amino)cyclohex-2-en-1-one, 95%, 2-Cyclohexen-1-one, 3-((2-bromophenyl)amino)-, 95%, 3–((2–Bromophenyl)amino)cyclohex–2–enone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-(2-bromoanilino)cyclohex-2-en-1-one (CAS 68890-19-7) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 3-(2-bromoanilino)cyclohex-2-en-1-one. InChIKey: FRCSXFPFMIQSLE-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 3-(2-bromoanilino)cyclohex-2-en-1-one |
| InChIKey | FRCSXFPFMIQSLE-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)NC2=CC=CC=C2Br |
Computed by PubChem (NCBI)