CAS 1369347-95-4 appears in our catalog under these names: 3-Bromo-1H-thieno(2,3-c)pyrazole-5-carboxylic acid, 95%, 3-Bromo-1H-thieno(2,3-c)pyrazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-bromo-2H-thieno[2,3-c]pyrazole-5-carboxylic acid (CAS 1369347-95-4) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 3-bromo-2H-thieno[2,3-c]pyrazole-5-carboxylic acid. InChIKey: RIIVCOUPQOVFQO-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 3-bromo-2H-thieno[2,3-c]pyrazole-5-carboxylic acid |
| InChIKey | RIIVCOUPQOVFQO-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=NNC(=C21)Br)C(=O)O |
Computed by PubChem (NCBI)