CAS 901122-45-0 appears in our catalog under these names: 2-Bromoimidazo(5,1-b)thiazole-7-carboxylic acid, 95+%, 2-Bromoimidazo(4,3-b)(1,3)thiazole-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-bromoimidazo[5,1-b][1,3]thiazole-7-carboxylic acid (CAS 901122-45-0) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 2-bromoimidazo[5,1-b][1,3]thiazole-7-carboxylic acid. InChIKey: MZUGTYNTVCMQLF-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 2-bromoimidazo[5,1-b][1,3]thiazole-7-carboxylic acid |
| InChIKey | MZUGTYNTVCMQLF-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C(N=CN21)C(=O)O)Br |
Computed by PubChem (NCBI)