CAS 1388027-23-3 is the registry number for 6-Bromothieno[3,2-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 1388027-23-3) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 6-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: WJIQQWUMNGPNJA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 6-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | WJIQQWUMNGPNJA-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1NC(=O)NC2=O)Br |
Computed by PubChem (NCBI)