Products 2284561-19-7

CAS 2284561-19-7 is the registry number for 2-Bromoimidazo[5,1-b]thiazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-bromoimidazo[5,1-b][1,3]thiazole-3-carboxylic acid (CAS 2284561-19-7) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 2-bromoimidazo[5,1-b][1,3]thiazole-3-carboxylic acid. InChIKey: IIGPPCBKVVZEQP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrN2O2S
Molecular weight247.07 g/mol
IUPAC name2-bromoimidazo[5,1-b][1,3]thiazole-3-carboxylic acid
InChIKeyIIGPPCBKVVZEQP-UHFFFAOYSA-N
SMILESC1=C2N(C=N1)C(=C(S2)Br)C(=O)O

Computed by PubChem (NCBI)