Products 2796324-14-4

CAS 2796324-14-4 is the registry number for 2-Bromopyrazolo[5,1-b]thiazole-7-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromopyrazolo[5,1-b][1,3]thiazole-7-carboxylic acid (CAS 2796324-14-4) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 2-bromopyrazolo[5,1-b][1,3]thiazole-7-carboxylic acid. InChIKey: JIMNCOLYBPPQBX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrN2O2S
Molecular weight247.07 g/mol
IUPAC name2-bromopyrazolo[5,1-b][1,3]thiazole-7-carboxylic acid
InChIKeyJIMNCOLYBPPQBX-UHFFFAOYSA-N
SMILESC1=C(SC2=C(C=NN21)C(=O)O)Br

Computed by PubChem (NCBI)