CAS 2796324-14-4 is the registry number for 2-Bromopyrazolo[5,1-b]thiazole-7-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromopyrazolo[5,1-b][1,3]thiazole-7-carboxylic acid (CAS 2796324-14-4) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 2-bromopyrazolo[5,1-b][1,3]thiazole-7-carboxylic acid. InChIKey: JIMNCOLYBPPQBX-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 2-bromopyrazolo[5,1-b][1,3]thiazole-7-carboxylic acid |
| InChIKey | JIMNCOLYBPPQBX-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C(C=NN21)C(=O)O)Br |
Computed by PubChem (NCBI)