CAS 1369774-49-1 is the registry number for 4-Bromo-2-methoxy-N,N-dimethylbenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-methoxy-N,N-dimethylbenzamide (CAS 1369774-49-1) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 4-bromo-2-methoxy-N,N-dimethylbenzamide. InChIKey: OWYDPABCMCTKAQ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-bromo-2-methoxy-N,N-dimethylbenzamide |
| InChIKey | OWYDPABCMCTKAQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)Br)OC |
Computed by PubChem (NCBI)