CAS 1369813-93-3 is the registry number for 2-Bromo-5-isopropylbenzonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-bromo-5-propan-2-ylbenzonitrile (CAS 1369813-93-3) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 2-bromo-5-propan-2-ylbenzonitrile. InChIKey: FWMPFJGZEFOFSQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 2-bromo-5-propan-2-ylbenzonitrile |
| InChIKey | FWMPFJGZEFOFSQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)Br)C#N |
Computed by PubChem (NCBI)