CAS 1369848-72-5 is the registry number for 3-Bromo-5-methoxy-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-5-methoxy-N,N-dimethylbenzamide (CAS 1369848-72-5) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 3-bromo-5-methoxy-N,N-dimethylbenzamide. InChIKey: DKGBZUQWZGCUGR-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 3-bromo-5-methoxy-N,N-dimethylbenzamide |
| InChIKey | DKGBZUQWZGCUGR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)OC |
Computed by PubChem (NCBI)