Products 1369869-37-3
CAS 1369869-37-3 is the registry number for 3-Bromo-5-chloro-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-5-chloro-N,N-dimethylbenzamide (CAS 1369869-37-3) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: 3-bromo-5-chloro-N,N-dimethylbenzamide. InChIKey: KJRIKRIDLYLPBS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | 3-bromo-5-chloro-N,N-dimethylbenzamide |
| InChIKey | KJRIKRIDLYLPBS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)