Products 1369883-79-3

CAS 1369883-79-3 is the registry number for 3-Isopropyl-5-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-nitro-5-propan-2-ylbenzoic acid (CAS 1369883-79-3) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 3-nitro-5-propan-2-ylbenzoic acid. InChIKey: HYEDLTBPUAEFGF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO4
Molecular weight209.20 g/mol
IUPAC name3-nitro-5-propan-2-ylbenzoic acid
InChIKeyHYEDLTBPUAEFGF-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)