CAS 1369887-78-4 is the registry number for 3-Hydroxy-n,n-dimethyl-5-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-hydroxy-N,N-dimethyl-5-nitrobenzamide (CAS 1369887-78-4) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 3-hydroxy-N,N-dimethyl-5-nitrobenzamide. InChIKey: BMHPHGHLBLKFBI-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 3-hydroxy-N,N-dimethyl-5-nitrobenzamide |
| InChIKey | BMHPHGHLBLKFBI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)