CAS 1369900-22-0 appears in our catalog under these names: 4-Bromo-3-chloro-N,N-dimethylbenzamide, 95%, 4-Bromo-3-chloro-N,N-dimethylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-bromo-3-chloro-N,N-dimethylbenzamide (CAS 1369900-22-0) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: 4-bromo-3-chloro-N,N-dimethylbenzamide. InChIKey: YDZUJZNFBSMIAA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | 4-bromo-3-chloro-N,N-dimethylbenzamide |
| InChIKey | YDZUJZNFBSMIAA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)