CAS 2055840-33-8 is the registry number for 6-Chloro-7-methyl-2,3-dihydro-1h-inden-1-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-chloro-7-methyl-2,3-dihydroinden-1-one;hydrochloride (CAS 2055840-33-8) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 6-chloro-7-methyl-2,3-dihydroinden-1-one;hydrochloride. InChIKey: IXUYPDLSDXQKDZ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 6-chloro-7-methyl-2,3-dihydroinden-1-one;hydrochloride |
| InChIKey | IXUYPDLSDXQKDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)CC2)Cl.Cl |
Computed by PubChem (NCBI)