Products 1421711-89-8

CAS 1421711-89-8 is the registry number for 2-(2-chlorophenyl)butanoyl chloride. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-chlorophenyl)butanoyl chloride (CAS 1421711-89-8) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 2-(2-chlorophenyl)butanoyl chloride. InChIKey: ZAEOLCPMSFWXLG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10Cl2O
Molecular weight217.09 g/mol
IUPAC name2-(2-chlorophenyl)butanoyl chloride
InChIKeyZAEOLCPMSFWXLG-UHFFFAOYSA-N
SMILESCCC(C1=CC=CC=C1Cl)C(=O)Cl

Computed by PubChem (NCBI)