CAS 109300-45-0 is the registry number for 2,2-Dichloro-1-(3,4-dimethyl-phenyl)-Ethanone. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dichloro-1-(3,4-dimethylphenyl)ethanone (CAS 109300-45-0) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 2,2-dichloro-1-(3,4-dimethylphenyl)ethanone. InChIKey: MDHLPKNCNRRECR-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2,2-dichloro-1-(3,4-dimethylphenyl)ethanone |
| InChIKey | MDHLPKNCNRRECR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(Cl)Cl)C |
Computed by PubChem (NCBI)