CAS 33666-40-9 is the registry number for ((2,2-Dichlorocyclopropyl)methoxy)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-dichlorocyclopropyl)methoxybenzene (CAS 33666-40-9) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: (2,2-dichlorocyclopropyl)methoxybenzene. InChIKey: ASAXEAXTLCZSGH-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | (2,2-dichlorocyclopropyl)methoxybenzene |
| InChIKey | ASAXEAXTLCZSGH-UHFFFAOYSA-N |
| SMILES | C1C(C1(Cl)Cl)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)