CAS 51631-64-2 is the registry number for 2-(4-chlorophenyl)butanoyl chloride. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)butanoyl chloride (CAS 51631-64-2) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 2-(4-chlorophenyl)butanoyl chloride. InChIKey: CNMQEWSDVFYUSX-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2-(4-chlorophenyl)butanoyl chloride |
| InChIKey | CNMQEWSDVFYUSX-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)