CAS 1370406-77-1 is the registry number for (R)-2-Benzyl-N,N-dimethylaziridine-1-sulfonamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-benzyl-N,N-dimethylaziridine-1-sulfonamide (CAS 1370406-77-1) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 2-benzyl-N,N-dimethylaziridine-1-sulfonamide. InChIKey: BLDWVIFYJWKNPQ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 2-benzyl-N,N-dimethylaziridine-1-sulfonamide |
| InChIKey | BLDWVIFYJWKNPQ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1CC1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)