Products 1370618-05-5
CAS 1370618-05-5 is the registry number for trans-1-(4-Chlorophenyl)-3-hydroxy-3-methylcyclobutanecarboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chlorophenyl)-3-hydroxy-3-methylcyclobutane-1-carboxylic acid (CAS 1370618-05-5) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-hydroxy-3-methylcyclobutane-1-carboxylic acid. InChIKey: RTLIMQZEVBOEKT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-hydroxy-3-methylcyclobutane-1-carboxylic acid |
| InChIKey | RTLIMQZEVBOEKT-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)(C2=CC=C(C=C2)Cl)C(=O)O)O |
Computed by PubChem (NCBI)