Products 13707-88-5
CAS 13707-88-5 appears in our catalog under these names: Alprenolol HCl, Alprenolol Hydrochloride, >95% (HPLC), Alprenolol Hydrochloride, Alprenolol hydrochloride, Alprenolol hydrochloride/ 99.91% (existing batch purity). Offered by: Chemat Brand, TRC, LoGiCal, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 25mg, 50mg, 10mg, 100mg, 200mg, 10mM (in 1ml dmso), 500mg.
1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride (CAS 13707-88-5) is a chemical compound with the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. IUPAC name: 1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride. InChIKey: RRCPAXJDDNWJBI-UHFFFAOYSA-N.
| Molecular formula | C15H24ClNO2 |
|---|---|
| Molecular weight | 285.81 g/mol |
| IUPAC name | 1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
| InChIKey | RRCPAXJDDNWJBI-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC=C1CC=C)O.Cl |
Computed by PubChem (NCBI)