CAS 148262-77-5 appears in our catalog under these names: (+)-O-Desmethyl Tramadol Hydrochloride (>90%), (+)-O-Desmethyl Tramadol Hydrochloride (1.0 mg/mL in Methanol). Offered by: TRC. Available pack sizes: 1mg, 1x1ml.
3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol;hydrochloride (CAS 148262-77-5) is a chemical compound with the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. IUPAC name: 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol;hydrochloride. InChIKey: IRGWVAWLHXDKIX-PBCQUBLHSA-N.
| Molecular formula | C15H24ClNO2 |
|---|---|
| Molecular weight | 285.81 g/mol |
| IUPAC name | 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol;hydrochloride |
| InChIKey | IRGWVAWLHXDKIX-PBCQUBLHSA-N |
| SMILES | CN(C)C[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)O)O.Cl |
Computed by PubChem (NCBI)