CAS 148218-19-3 is the registry number for (-)-O-Desmethyl Tramadol Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 2mg, 5mg.
3-[(1S,2S)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol;hydrochloride (CAS 148218-19-3) is a chemical compound with the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. IUPAC name: 3-[(1S,2S)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol;hydrochloride. InChIKey: IRGWVAWLHXDKIX-NQQJLSKUSA-N.
| Molecular formula | C15H24ClNO2 |
|---|---|
| Molecular weight | 285.81 g/mol |
| IUPAC name | 3-[(1S,2S)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol;hydrochloride |
| InChIKey | IRGWVAWLHXDKIX-NQQJLSKUSA-N |
| SMILES | CN(C)C[C@@H]1CCCC[C@]1(C2=CC(=CC=C2)O)O.Cl |
Computed by PubChem (NCBI)