CAS 130198-05-9 appears in our catalog under these names: Venlafaxine EP Impurity C HCl, Venlafaxine EP Impurity C HCl (N,N-Didesmethyl Venlafaxine HCl), 1-(2-Amino-1-(4-methoxyphenyl)ethyl)cyclohexanol Hydrochloride, >95% (HPLC), 1-((1RS)-2-Amino-1-(4-methoxyphenyl)ethyl)cyclohexanol Hydrochloride, 1–(2–Amino–1–(4–methoxyphenyl)ethyl)cyclohexanol Hydrochloride. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 10g, 25g, 5g, 4x25mg, 25mg, 100mg, 100g.
1-[2-amino-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride (CAS 130198-05-9) is a chemical compound with the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. IUPAC name: 1-[2-amino-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride. InChIKey: NTKXIDDUCSFBBF-UHFFFAOYSA-N.
| Molecular formula | C15H24ClNO2 |
|---|---|
| Molecular weight | 285.81 g/mol |
| IUPAC name | 1-[2-amino-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride |
| InChIKey | NTKXIDDUCSFBBF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CN)C2(CCCCC2)O.Cl |
Computed by PubChem (NCBI)