Products 1261398-09-7
CAS 1261398-09-7 is the registry number for rac N-Desmethyl Tramadol-d3 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
Cis-(1R,2R)-1-(3-methoxyphenyl)-2-[(trideuteriomethylamino)methyl]cyclohexan-1-ol;hydrochloride (CAS 1261398-09-7) is a chemical compound with the molecular formula C15H24ClNO2 and a molecular weight of 288.83 g/mol. IUPAC name: cis-(1R,2R)-1-(3-methoxyphenyl)-2-[(trideuteriomethylamino)methyl]cyclohexan-1-ol;hydrochloride. InChIKey: NOZLWRHUQJHIRG-UOYBXXRGSA-N.
| Molecular formula | C15H24ClNO2 |
|---|---|
| Molecular weight | 288.83 g/mol |
| IUPAC name | cis-(1R,2R)-1-(3-methoxyphenyl)-2-[(trideuteriomethylamino)methyl]cyclohexan-1-ol;hydrochloride |
| InChIKey | NOZLWRHUQJHIRG-UOYBXXRGSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)OC)O.Cl |
Computed by PubChem (NCBI)