Products 1371856-10-8

CAS 1371856-10-8 is the registry number for Benzyl methyl isophthalate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

3-O-benzyl 1-O-methyl benzene-1,3-dicarboxylate (CAS 1371856-10-8) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 3-O-benzyl 1-O-methyl benzene-1,3-dicarboxylate. InChIKey: FIOJLICLLIFTTH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14O4
Molecular weight270.28 g/mol
IUPAC name3-O-benzyl 1-O-methyl benzene-1,3-dicarboxylate
InChIKeyFIOJLICLLIFTTH-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC=C1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)