Products 13721-20-5
CAS 13721-20-5 appears in our catalog under these names: (3-Chloro-4-methoxyphenyl)acetic acid, 95%, 2-(3-Chloro-4-methoxyphenyl)acetic acid, 98%, 3–Chloro–4–methoxyphenylacetic Acid, 3-Chloro-4-methoxyphenylacetic Acid, >97.0%(GC), (3-Chloro-4-methoxyphenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 200mg, 100mg.
2-(3-chloro-4-methoxyphenyl)acetic acid (CAS 13721-20-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)acetic acid. InChIKey: OARWXDXELDVNOC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)acetic acid |
| InChIKey | OARWXDXELDVNOC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(3-chloro-4-methoxyphenyl)acetic acid, 3-Chloro-4-methoxybenzeneacetic acid, (3-chloro-4-methoxyphenyl)acetic acid, 3-chloro-4-methoxyphenylacetic acid, Benzeneacetic acid, 3-chloro-4-methoxy-, Benzeneacetic acid,3-chloro-4-methoxy-, [3-Chloro-4-(methyloxy)phenyl]acetic acid, Benzeneacetic acid,3-chl, 2-(3-chloro-4-methoxy-phenyl)acetic acid