Products 1372124-93-0
CAS 1372124-93-0 is the registry number for 1,3-Dimesityl-1H-imidazol-3-ium hydrogen carbonate, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;hydrogen carbonate (CAS 1372124-93-0) is a chemical compound with the molecular formula C22H26N2O3 and a molecular weight of 366.5 g/mol. IUPAC name: 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;hydrogen carbonate. InChIKey: XLNGZTAIJOOIFH-UHFFFAOYSA-M.
| Molecular formula | C22H26N2O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;hydrogen carbonate |
| InChIKey | XLNGZTAIJOOIFH-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C.C(=O)(O)[O-] |
Computed by PubChem (NCBI)