Products 1372404-41-5
CAS 1372404-41-5 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-3-(oxazol-2-yl)propanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-oxazol-2-yl)propanoic acid (CAS 1372404-41-5) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-oxazol-2-yl)propanoic acid. InChIKey: YEMJJXLSSIFJBV-ZETCQYMHSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-oxazol-2-yl)propanoic acid |
| InChIKey | YEMJJXLSSIFJBV-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=NC=CO1)C(=O)O |
Computed by PubChem (NCBI)