Products 1372962-66-7
CAS 1372962-66-7 appears in our catalog under these names: 2-Phenylazetidine-2-carboxylic acid, 98%, 98%, 2-Phenylazetidine-2-carboxylic acid, 98%, 2-phenylazetidine-2-carboxylic acid, 97%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 500mg.
2-phenylazetidine-2-carboxylic acid (CAS 1372962-66-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 2-phenylazetidine-2-carboxylic acid. InChIKey: NQFJVVZTNXTAJU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-phenylazetidine-2-carboxylic acid |
| InChIKey | NQFJVVZTNXTAJU-UHFFFAOYSA-N |
| SMILES | C1CNC1(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)