CAS 137297-47-3 appears in our catalog under these names: 3'-Methoxyliquiritigenin, 7,4'-Dihydroxy-3'-methoxyflavanone. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
(2S)-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 137297-47-3) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (2S)-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: VSYNGSXKXHXJHX-AWEZNQCLSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2S)-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | VSYNGSXKXHXJHX-AWEZNQCLSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2CC(=O)C3=C(O2)C=C(C=C3)O)O |
Computed by PubChem (NCBI)