CAS 1373223-05-2 is the registry number for Methyl 2-amino-3,3,3-trifluoro-2-methylpropanoate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.
Methyl 2-amino-3,3,3-trifluoro-2-methylpropanoate;hydrochloride (CAS 1373223-05-2) is a chemical compound with the molecular formula C5H9ClF3NO2 and a molecular weight of 207.58 g/mol. IUPAC name: methyl 2-amino-3,3,3-trifluoro-2-methylpropanoate;hydrochloride. InChIKey: YCFVWFPXOOLBJA-UHFFFAOYSA-N.
| Molecular formula | C5H9ClF3NO2 |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | methyl 2-amino-3,3,3-trifluoro-2-methylpropanoate;hydrochloride |
| InChIKey | YCFVWFPXOOLBJA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)