CAS 1803598-91-5 appears in our catalog under these names: 4-Amino-3-(trifluoromethyl)butanoic acid hydrochloride, 95%, 4-Amino-3-(trifluoromethyl)butanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(aminomethyl)-4,4,4-trifluorobutanoic acid;hydrochloride (CAS 1803598-91-5) is a chemical compound with the molecular formula C5H9ClF3NO2 and a molecular weight of 207.58 g/mol. IUPAC name: 3-(aminomethyl)-4,4,4-trifluorobutanoic acid;hydrochloride. InChIKey: XRJPLXZCPPGEIE-UHFFFAOYSA-N.
| Molecular formula | C5H9ClF3NO2 |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | 3-(aminomethyl)-4,4,4-trifluorobutanoic acid;hydrochloride |
| InChIKey | XRJPLXZCPPGEIE-UHFFFAOYSA-N |
| SMILES | C(C(CN)C(F)(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)