CAS 1680174-93-9 appears in our catalog under these names: (S)–2–Amino–5,5,5–trifluoropentanoic acid hydrochloride, (2S)-2-Amino-5,5,5-trifluoropentanoic acid hydrochloride, (2S)-2-amino-5,5,5-trifluoropentanoic acid hydrochloride, 97%, 97%, (S)-2-Amino-5,5,5-trifluoropentanoic acid hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg.
(2S)-2-amino-5,5,5-trifluoropentanoic acid;hydrochloride (CAS 1680174-93-9) is a chemical compound with the molecular formula C5H9ClF3NO2 and a molecular weight of 207.58 g/mol. IUPAC name: (2S)-2-amino-5,5,5-trifluoropentanoic acid;hydrochloride. InChIKey: RQLCJLJVSWUYSK-DFWYDOINSA-N.
| Molecular formula | C5H9ClF3NO2 |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | (2S)-2-amino-5,5,5-trifluoropentanoic acid;hydrochloride |
| InChIKey | RQLCJLJVSWUYSK-DFWYDOINSA-N |
| SMILES | C(CC(F)(F)F)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)