CAS 1955522-89-0 is the registry number for 4-Amino-5,5,5-trifluoropentanoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-amino-5,5,5-trifluoropentanoic acid;hydrochloride (CAS 1955522-89-0) is a chemical compound with the molecular formula C5H9ClF3NO2 and a molecular weight of 207.58 g/mol. IUPAC name: 4-amino-5,5,5-trifluoropentanoic acid;hydrochloride. InChIKey: PBVOWYVDAMNWQT-UHFFFAOYSA-N.
| Molecular formula | C5H9ClF3NO2 |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | 4-amino-5,5,5-trifluoropentanoic acid;hydrochloride |
| InChIKey | PBVOWYVDAMNWQT-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)