CAS 1443979-43-8 is the registry number for 2-Amino-5,5,5-trifluoropentanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-5,5,5-trifluoropentanoic acid;hydrochloride (CAS 1443979-43-8) is a chemical compound with the molecular formula C5H9ClF3NO2 and a molecular weight of 207.58 g/mol. IUPAC name: 2-amino-5,5,5-trifluoropentanoic acid;hydrochloride. InChIKey: RQLCJLJVSWUYSK-UHFFFAOYSA-N.
| Molecular formula | C5H9ClF3NO2 |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | 2-amino-5,5,5-trifluoropentanoic acid;hydrochloride |
| InChIKey | RQLCJLJVSWUYSK-UHFFFAOYSA-N |
| SMILES | C(CC(F)(F)F)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)