Products 1443979-43-8

CAS 1443979-43-8 is the registry number for 2-Amino-5,5,5-trifluoropentanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-5,5,5-trifluoropentanoic acid;hydrochloride (CAS 1443979-43-8) is a chemical compound with the molecular formula C5H9ClF3NO2 and a molecular weight of 207.58 g/mol. IUPAC name: 2-amino-5,5,5-trifluoropentanoic acid;hydrochloride. InChIKey: RQLCJLJVSWUYSK-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClF3NO2
Molecular weight207.58 g/mol
IUPAC name2-amino-5,5,5-trifluoropentanoic acid;hydrochloride
InChIKeyRQLCJLJVSWUYSK-UHFFFAOYSA-N
SMILESC(CC(F)(F)F)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)